WolframAlpha computational knowledge AI
SMILES N1=C(C=CC=C1)C=1N(C=CC1)C=C molar free energy